C18H11F3IN5S — CID 89302742
2-N-(2-iodophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine (PubChem CID 89302742) has the molecular formula C18H11F3IN5S and a molecular weight of 513.29 g/mol. Its IUPAC name is 2-N-(2-iodophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine.
| Compound Name | 2-N-(2-iodophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 89302742 |
| Molecular Formula | C18H11F3IN5S |
| Molecular Weight | 513.29 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | 2-N-(2-iodophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
| SMILES | FC(F)(F)c1ccc(Nc2ncnc3sc(Nc4ccccc4I)nc23)cc1 |
| InChI | InChI=1S/C18H11F3IN5S/c19-18(20,21)10-5-7-11(8-6-10)25-15-14-16(24-9-23-15)28-17(27-14)26-13-4-2-1-3-12(13)22/h1-9H,(H,26,27)(H,23,24,25) |
| InChIKey | ZVAFORGHODCMPU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|