C18H14N6 — CID 19709380
4-N,6-N-diphenylpyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 19709380) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-N,6-N-diphenylpyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-diphenylpyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 19709380 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-N,6-N-diphenylpyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | c1ccc(Nc2ncc3ncnc(Nc4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C18H14N6/c1-3-7-13(8-4-1)22-17-16-15(20-12-21-17)11-19-18(24-16)23-14-9-5-2-6-10-14/h1-12H,(H,19,23,24)(H,20,21,22) |
| InChIKey | CKXWTKJOJXJCGJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |