C15H16N6O — CID 15295237
2-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol (PubChem CID 15295237) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol.
| Compound Name | 2-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 15295237 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
| SMILES | Cc1cccc(Nc2ncnc3cnc(NCCO)nc23)c1 |
| InChI | InChI=1S/C15H16N6O/c1-10-3-2-4-11(7-10)20-14-13-12(18-9-19-14)8-17-15(21-13)16-5-6-22/h2-4,7-9,22H,5-6H2,1H3,(H,16,17,21)(H,18,19,20) |
| InChIKey | GGVKEWYBTRAAKH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |