C35H38N8O4 — CID 157473704
6-(2-hydroxyethylamino)-4-(3-methylanilino)quinazolin-7-ol;6-(2-methoxyethylamino)-4-(3-methylanilino)quinazolin-7-ol (PubChem CID 157473704) has the molecular formula C35H38N8O4 and a molecular weight of 634.74 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-4-(3-methylanilino)quinazolin-7-ol;6-(2-methoxyethylamino)-4-(3-methylanilino)quinazolin-7-ol.
| Compound Name | 6-(2-hydroxyethylamino)-4-(3-methylanilino)quinazolin-7-ol;6-(2-methoxyethylamino)-4-(3-methylanilino)quinazolin-7-ol |
|---|---|
| PubChem CID | 157473704 |
| Molecular Formula | C35H38N8O4 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | 6-(2-hydroxyethylamino)-4-(3-methylanilino)quinazolin-7-ol;6-(2-methoxyethylamino)-4-(3-methylanilino)quinazolin-7-ol |
| SMILES | COCCNc1cc2c(Nc3cccc(C)c3)ncnc2cc1O.Cc1cccc(Nc2ncnc3cc(O)c(NCCO)cc23)c1 |
| InChI | InChI=1S/C18H20N4O2.C17H18N4O2/c1-12-4-3-5-13(8-12)22-18-14-9-16(19-6-7-24-2)17(23)10-15(14)20-11-21-18;1-11-3-2-4-12(7-11)21-17-13-8-15(18-5-6-22)16(23)9-14(13)19-10-20-17/h3-5,8-11,19,23H,6-7H2,1-2H3,(H,20,21,22);2-4,7-10,18,22-23H,5-6H2,1H3,(H,19,20,21) |
| InChIKey | BVIHZLOFBQLSOW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 169.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|