C25H25N3O2 — CID 11014847
6,7-diethoxy-N-[3-(3-methylphenyl)phenyl]quinazolin-4-amine (PubChem CID 11014847) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 6,7-diethoxy-N-[3-(3-methylphenyl)phenyl]quinazolin-4-amine.
| Compound Name | 6,7-diethoxy-N-[3-(3-methylphenyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 11014847 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 6,7-diethoxy-N-[3-(3-methylphenyl)phenyl]quinazolin-4-amine |
| SMILES | CCOc1cc2ncnc(Nc3cccc(-c4cccc(C)c4)c3)c2cc1OCC |
| InChI | InChI=1S/C25H25N3O2/c1-4-29-23-14-21-22(15-24(23)30-5-2)26-16-27-25(21)28-20-11-7-10-19(13-20)18-9-6-8-17(3)12-18/h6-16H,4-5H2,1-3H3,(H,26,27,28) |
| InChIKey | FEANNKPAELZFMT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |