C20H24ClN3O2 — CID 68570553
6,7-diethoxy-N-(3-ethylphenyl)quinazolin-4-amine;hydrochloride (PubChem CID 68570553) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 6,7-diethoxy-N-(3-ethylphenyl)quinazolin-4-amine;hydrochloride.
| Compound Name | 6,7-diethoxy-N-(3-ethylphenyl)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 68570553 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 6,7-diethoxy-N-(3-ethylphenyl)quinazolin-4-amine;hydrochloride |
| SMILES | CCOc1cc2ncnc(Nc3cccc(CC)c3)c2cc1OCC.Cl |
| InChI | InChI=1S/C20H23N3O2.ClH/c1-4-14-8-7-9-15(10-14)23-20-16-11-18(24-5-2)19(25-6-3)12-17(16)21-13-22-20;/h7-13H,4-6H2,1-3H3,(H,21,22,23);1H |
| InChIKey | UBJKTYRKAVZTFC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |