C21H20N4O3 — CID 10172616
6,7-diethoxy-N-[3-(1,3-oxazol-4-yl)phenyl]quinazolin-4-amine (PubChem CID 10172616) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 6,7-diethoxy-N-[3-(1,3-oxazol-4-yl)phenyl]quinazolin-4-amine.
| Compound Name | 6,7-diethoxy-N-[3-(1,3-oxazol-4-yl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 10172616 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 6,7-diethoxy-N-[3-(1,3-oxazol-4-yl)phenyl]quinazolin-4-amine |
| SMILES | CCOc1cc2ncnc(Nc3cccc(-c4cocn4)c3)c2cc1OCC |
| InChI | InChI=1S/C21H20N4O3/c1-3-27-19-9-16-17(10-20(19)28-4-2)22-12-23-21(16)25-15-7-5-6-14(8-15)18-11-26-13-24-18/h5-13H,3-4H2,1-2H3,(H,22,23,25) |
| InChIKey | IOCCYZUACQGGIM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |