C15H10Cl2N6 — CID 19709364
4-N-(3,4-dichlorophenyl)-6-N-prop-2-ynylpyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 19709364) has the molecular formula C15H10Cl2N6 and a molecular weight of 345.19 g/mol. Its IUPAC name is 4-N-(3,4-dichlorophenyl)-6-N-prop-2-ynylpyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dichlorophenyl)-6-N-prop-2-ynylpyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 19709364 |
| Molecular Formula | C15H10Cl2N6 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4-N-(3,4-dichlorophenyl)-6-N-prop-2-ynylpyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | C#CCNc1ncc2ncnc(Nc3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C15H10Cl2N6/c1-2-5-18-15-19-7-12-13(23-15)14(21-8-20-12)22-9-3-4-10(16)11(17)6-9/h1,3-4,6-8H,5H2,(H,18,19,23)(H,20,21,22) |
| InChIKey | IQEWKFDFUYHSDC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|