C15H13N5Na2 — CID 172854912
CID 172854912 (PubChem CID 172854912) has the molecular formula C15H13N5Na2 and a molecular weight of 309.28 g/mol.
| Compound Name | CID 172854912 |
|---|---|
| PubChem CID | 172854912 |
| Molecular Formula | C15H13N5Na2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | — |
| SMILES | [Na].[Na].c1ccc(Nc2ncnc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H13N5.2Na/c1-3-7-12(8-4-1)18-14-16-11-17-15(20-14)19-13-9-5-2-6-10-13;;/h1-11H,(H2,16,17,18,19,20);; |
| InChIKey | YOHZEBRKHBBBFL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |