C17H15N7O2 — CID 23876655
1-phenyl-3-[4-(phenylcarbamoylamino)-1,3,5-triazin-2-yl]urea (PubChem CID 23876655) has the molecular formula C17H15N7O2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-phenyl-3-[4-(phenylcarbamoylamino)-1,3,5-triazin-2-yl]urea.
| Compound Name | 1-phenyl-3-[4-(phenylcarbamoylamino)-1,3,5-triazin-2-yl]urea |
|---|---|
| PubChem CID | 23876655 |
| Molecular Formula | C17H15N7O2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-phenyl-3-[4-(phenylcarbamoylamino)-1,3,5-triazin-2-yl]urea |
| SMILES | O=C(Nc1ccccc1)Nc1ncnc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H15N7O2/c25-16(20-12-7-3-1-4-8-12)23-14-18-11-19-15(22-14)24-17(26)21-13-9-5-2-6-10-13/h1-11H,(H4,18,19,20,21,22,23,24,25,26) |
| InChIKey | MNXNMNBGQRGFGK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |