C14H13N5O — CID 110472243
1-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-3-phenylurea (PubChem CID 110472243) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-3-phenylurea.
| Compound Name | 1-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-3-phenylurea |
|---|---|
| PubChem CID | 110472243 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-3-phenylurea |
| SMILES | Cc1ccc2nc(NC(=O)Nc3ccccc3)nn2c1 |
| InChI | InChI=1S/C14H13N5O/c1-10-7-8-12-16-13(18-19(12)9-10)17-14(20)15-11-5-3-2-4-6-11/h2-9H,1H3,(H2,15,17,18,20) |
| InChIKey | CJHARWIKIDJDLS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |