About 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid
2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid (PubChem CID 83866305) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid.
Analyze 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid?
The IUPAC name of 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid (CID 83866305) is 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid.
What is the SMILES notation for 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid?
The canonical SMILES for 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid is Cc1ccc2nc(CC(=O)O)nn2c1.
What is the InChIKey of 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid?
The InChIKey is CACVEVWVHHYAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6-2-3-8-10-7(4-9(13)14)11-12(8)5-6/h2-3,5H,4H2,1H3,(H,13,14).
What are the key properties of 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid?
2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid has a molecular weight of 191.19 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)acetic acid is sourced from PubChem (CID 83866305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).