C9H10ClN3 — CID 116989594
2-(2-chloroethyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 116989594) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(2-chloroethyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 116989594 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(2-chloroethyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1ccc2nc(CCCl)nn2c1 |
| InChI | InChI=1S/C9H10ClN3/c1-7-2-3-9-11-8(4-5-10)12-13(9)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | NAQQQWNNTWAZCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|