C9H10ClN3 — CID 117130665
6-chloro-2-propyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117130665) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 6-chloro-2-propyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-chloro-2-propyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117130665 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 6-chloro-2-propyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCCc1nc2ccc(Cl)cn2n1 |
| InChI | InChI=1S/C9H10ClN3/c1-2-3-8-11-9-5-4-7(10)6-13(9)12-8/h4-6H,2-3H2,1H3 |
| InChIKey | PMEWUIFGCLITMT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |