C10H14N6O — CID 83113923
2-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea (PubChem CID 83113923) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea.
| Compound Name | 2-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83113923 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea |
| SMILES | Cc1ccc2nc(NCCNC(N)=O)nn2c1 |
| InChI | InChI=1S/C10H14N6O/c1-7-2-3-8-14-10(15-16(8)6-7)13-5-4-12-9(11)17/h2-3,6H,4-5H2,1H3,(H,13,15)(H3,11,12,17) |
| InChIKey | BDEOOTYBXWZNTR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|