C14H22N4O — CID 106012435
6-methyl-N-(4-propan-2-yloxybutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 106012435) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-methyl-N-(4-propan-2-yloxybutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-methyl-N-(4-propan-2-yloxybutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 106012435 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6-methyl-N-(4-propan-2-yloxybutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1ccc2nc(NCCCCOC(C)C)nn2c1 |
| InChI | InChI=1S/C14H22N4O/c1-11(2)19-9-5-4-8-15-14-16-13-7-6-12(3)10-18(13)17-14/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,15,17) |
| InChIKey | DIKZMXBCIWFFFJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|