C12H17FN4O — CID 107850356
6-[(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]hexan-1-ol (PubChem CID 107850356) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 6-[(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]hexan-1-ol.
| Compound Name | 6-[(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 107850356 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-[(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]hexan-1-ol |
| SMILES | OCCCCCCNc1nc2ccc(F)cn2n1 |
| InChI | InChI=1S/C12H17FN4O/c13-10-5-6-11-15-12(16-17(11)9-10)14-7-3-1-2-4-8-18/h5-6,9,18H,1-4,7-8H2,(H,14,16) |
| InChIKey | ZPZFJIVHRCAVLA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|