C12H17ClN4O — CID 114152105
5-[(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-2-methylpentan-1-ol (PubChem CID 114152105) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-[(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 114152105 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-[(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNc1nc2ccc(Cl)cn2n1 |
| InChI | InChI=1S/C12H17ClN4O/c1-9(8-18)3-2-6-14-12-15-11-5-4-10(13)7-17(11)16-12/h4-5,7,9,18H,2-3,6,8H2,1H3,(H,14,16) |
| InChIKey | GKSJUSBBFLATFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|