C13H23N3O3 — CID 106012404
4,6-dimethoxy-N-(4-propan-2-yloxybutyl)pyrimidin-2-amine (PubChem CID 106012404) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(4-propan-2-yloxybutyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(4-propan-2-yloxybutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106012404 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4,6-dimethoxy-N-(4-propan-2-yloxybutyl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NCCCCOC(C)C)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-10(2)19-8-6-5-7-14-13-15-11(17-3)9-12(16-13)18-4/h9-10H,5-8H2,1-4H3,(H,14,15,16) |
| InChIKey | FDMHDOVFDHJKJG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|