C11H15N3O2 — CID 106222455
4,6-dimethoxy-N-pent-4-ynylpyrimidin-2-amine (PubChem CID 106222455) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4,6-dimethoxy-N-pent-4-ynylpyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-pent-4-ynylpyrimidin-2-amine |
|---|---|
| PubChem CID | 106222455 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4,6-dimethoxy-N-pent-4-ynylpyrimidin-2-amine |
| SMILES | C#CCCCNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C11H15N3O2/c1-4-5-6-7-12-11-13-9(15-2)8-10(14-11)16-3/h1,8H,5-7H2,2-3H3,(H,12,13,14) |
| InChIKey | RBWNKNCZBKLWNB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|