C9H11N3O — CID 112690842
N-but-3-ynyl-4-methoxypyrimidin-2-amine (PubChem CID 112690842) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is N-but-3-ynyl-4-methoxypyrimidin-2-amine.
| Compound Name | N-but-3-ynyl-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112690842 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-but-3-ynyl-4-methoxypyrimidin-2-amine |
| SMILES | C#CCCNc1nccc(OC)n1 |
| InChI | InChI=1S/C9H11N3O/c1-3-4-6-10-9-11-7-5-8(12-9)13-2/h1,5,7H,4,6H2,2H3,(H,10,11,12) |
| InChIKey | QYILLBFYSRNRQF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|