C10H18N4O — CID 112683349
N-(4-methoxypyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 112683349) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(4-methoxypyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(4-methoxypyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 112683349 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(4-methoxypyrimidin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccnc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C10H18N4O/c1-14(2)8-4-6-11-10-12-7-5-9(13-10)15-3/h5,7H,4,6,8H2,1-3H3,(H,11,12,13) |
| InChIKey | LYJGOGCJJPIDEK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|