C10H17N3O2 — CID 19737713
N-butyl-4,6-dimethoxypyrimidin-2-amine (PubChem CID 19737713) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-butyl-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-butyl-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 19737713 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-butyl-4,6-dimethoxypyrimidin-2-amine |
| SMILES | CCCCNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-5-6-11-10-12-8(14-2)7-9(13-10)15-3/h7H,4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | GWULQLGIAFAUGG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|