C13H23N3O4 — CID 115749068
4,6-dimethoxy-N-[4-(2-methoxyethoxy)butyl]pyrimidin-2-amine (PubChem CID 115749068) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4,6-dimethoxy-N-[4-(2-methoxyethoxy)butyl]pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-[4-(2-methoxyethoxy)butyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 115749068 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4,6-dimethoxy-N-[4-(2-methoxyethoxy)butyl]pyrimidin-2-amine |
| SMILES | COCCOCCCCNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H23N3O4/c1-17-8-9-20-7-5-4-6-14-13-15-11(18-2)10-12(16-13)19-3/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | RIAJZFSNWJKKMQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|