About 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol
1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol (PubChem CID 104594186) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol |
| PubChem CID | 104594186 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol |
| SMILES | COc1cc(OC)nc(NCCNCC(C)O)n1 |
| InChI | InChI=1S/C11H20N4O3/c1-8(16)7-12-4-5-13-11-14-9(17-2)6-10(15-11)18-3/h6,8,12,16H,4-5,7H2,1-3H3,(H,13,14,15) |
| InChIKey | HSFXAQITEALIHE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol?
The IUPAC name of 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol (CID 104594186) is 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol.
What is the SMILES notation for 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol?
The canonical SMILES for 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol is COc1cc(OC)nc(NCCNCC(C)O)n1.
What is the InChIKey of 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol?
The InChIKey is HSFXAQITEALIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c1-8(16)7-12-4-5-13-11-14-9(17-2)6-10(15-11)18-3/h6,8,12,16H,4-5,7H2,1-3H3,(H,13,14,15).
What are the key properties of 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol?
1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol has a molecular weight of 256.31 g/mol, XLogP of -0.12, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]ethylamino]propan-2-ol is sourced from PubChem (CID 104594186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).