C9H16ClN5O2 — CID 113430529
1-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethylamino]propan-2-ol (PubChem CID 113430529) has the molecular formula C9H16ClN5O2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 1-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 113430529 |
| Molecular Formula | C9H16ClN5O2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethylamino]propan-2-ol |
| SMILES | COc1nc(Cl)nc(NCCNCC(C)O)n1 |
| InChI | InChI=1S/C9H16ClN5O2/c1-6(16)5-11-3-4-12-8-13-7(10)14-9(15-8)17-2/h6,11,16H,3-5H2,1-2H3,(H,12,13,14,15) |
| InChIKey | CJKWVMJJQKHTKA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|