C9H15ClN6O2 — CID 83113419
3-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83113419) has the molecular formula C9H15ClN6O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 3-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83113419 |
| Molecular Formula | C9H15ClN6O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | COc1nc(Cl)nc(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C9H15ClN6O2/c1-16(2)9(17)12-5-4-11-7-13-6(10)14-8(15-7)18-3/h4-5H2,1-3H3,(H,12,17)(H,11,13,14,15) |
| InChIKey | ZTMIJLIHTCIQNU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|