C9H13ClN4OS — CID 106430118
4-chloro-6-methoxy-N-(2-prop-2-enylsulfanylethyl)-1,3,5-triazin-2-amine (PubChem CID 106430118) has the molecular formula C9H13ClN4OS and a molecular weight of 260.75 g/mol. Its IUPAC name is 4-chloro-6-methoxy-N-(2-prop-2-enylsulfanylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methoxy-N-(2-prop-2-enylsulfanylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106430118 |
| Molecular Formula | C9H13ClN4OS |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-chloro-6-methoxy-N-(2-prop-2-enylsulfanylethyl)-1,3,5-triazin-2-amine |
| SMILES | C=CCSCCNc1nc(Cl)nc(OC)n1 |
| InChI | InChI=1S/C9H13ClN4OS/c1-3-5-16-6-4-11-8-12-7(10)13-9(14-8)15-2/h3H,1,4-6H2,2H3,(H,11,12,13,14) |
| InChIKey | RKPRBPXODXOSFE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|