C11H17N3O2S — CID 106430202
4,6-dimethoxy-N-(2-prop-2-enylsulfanylethyl)pyrimidin-2-amine (PubChem CID 106430202) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(2-prop-2-enylsulfanylethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(2-prop-2-enylsulfanylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106430202 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4,6-dimethoxy-N-(2-prop-2-enylsulfanylethyl)pyrimidin-2-amine |
| SMILES | C=CCSCCNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C11H17N3O2S/c1-4-6-17-7-5-12-11-13-9(15-2)8-10(14-11)16-3/h4,8H,1,5-7H2,2-3H3,(H,12,13,14) |
| InChIKey | LFENNHPJVLZRFZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|