C10H14ClN3S — CID 104924087
6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine (PubChem CID 104924087) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104924087 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine |
| SMILES | C=CCSCCNc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3S/c1-2-4-15-5-3-13-10-7-8(12)6-9(11)14-10/h2,6-7H,1,3-5H2,(H3,12,13,14) |
| InChIKey | YOKNZCJSHKRSFT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|