About 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine
6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine (PubChem CID 104924087) has the molecular formula C10H14ClN3S
and a molecular weight of 243.76 g/mol. Its IUPAC name is 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine |
| PubChem CID | 104924087 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine |
| SMILES | C=CCSCCNc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3S/c1-2-4-15-5-3-13-10-7-8(12)6-9(11)14-10/h2,6-7H,1,3-5H2,(H3,12,13,14) |
| InChIKey | YOKNZCJSHKRSFT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine?
The IUPAC name of 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine (CID 104924087) is 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine.
What is the SMILES notation for 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine?
The canonical SMILES for 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine is C=CCSCCNc1cc(N)cc(Cl)n1.
What is the InChIKey of 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine?
The InChIKey is YOKNZCJSHKRSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3S/c1-2-4-15-5-3-13-10-7-8(12)6-9(11)14-10/h2,6-7H,1,3-5H2,(H3,12,13,14).
What are the key properties of 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine?
6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine has a molecular weight of 243.76 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N-(2-prop-2-enylsulfanylethyl)pyridine-2,4-diamine is sourced from PubChem (CID 104924087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).