C7H13N5S — CID 106433852
3-N-(2-prop-2-enylsulfanylethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 106433852) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-N-(2-prop-2-enylsulfanylethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-prop-2-enylsulfanylethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 106433852 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 3-N-(2-prop-2-enylsulfanylethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | C=CCSCCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C7H13N5S/c1-2-4-13-5-3-9-7-10-6(8)11-12-7/h2H,1,3-5H2,(H4,8,9,10,11,12) |
| InChIKey | UNNSJJBYDDNHEC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|