C7H15N5O — CID 104766883
3-N-(2-propan-2-yloxyethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 104766883) has the molecular formula C7H15N5O and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-N-(2-propan-2-yloxyethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-propan-2-yloxyethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 104766883 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 3-N-(2-propan-2-yloxyethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)OCCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C7H15N5O/c1-5(2)13-4-3-9-7-10-6(8)11-12-7/h5H,3-4H2,1-2H3,(H4,8,9,10,11,12) |
| InChIKey | UPQBYBRRGBXYPV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|