C8H17N5O — CID 66274500
3-N-(2-butoxyethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 66274500) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-N-(2-butoxyethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-butoxyethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 66274500 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-N-(2-butoxyethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CCCCOCCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C8H17N5O/c1-2-3-5-14-6-4-10-8-11-7(9)12-13-8/h2-6H2,1H3,(H4,9,10,11,12,13) |
| InChIKey | GXVGWSSTSSHMEH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|