C11H19BrN4O — CID 116797411
6-bromo-2-N-(3-butoxypropyl)pyrimidine-2,4-diamine (PubChem CID 116797411) has the molecular formula C11H19BrN4O and a molecular weight of 303.20 g/mol. Its IUPAC name is 6-bromo-2-N-(3-butoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-(3-butoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116797411 |
| Molecular Formula | C11H19BrN4O |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 6-bromo-2-N-(3-butoxypropyl)pyrimidine-2,4-diamine |
| SMILES | CCCCOCCCNc1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C11H19BrN4O/c1-2-3-6-17-7-4-5-14-11-15-9(12)8-10(13)16-11/h8H,2-7H2,1H3,(H3,13,14,15,16) |
| InChIKey | HNHORUFRDGQFMV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|