C12H20BrN3O — CID 103518486
5-bromo-4-N-(3-butoxypropyl)pyridine-3,4-diamine (PubChem CID 103518486) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is 5-bromo-4-N-(3-butoxypropyl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(3-butoxypropyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518486 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-bromo-4-N-(3-butoxypropyl)pyridine-3,4-diamine |
| SMILES | CCCCOCCCNc1c(N)cncc1Br |
| InChI | InChI=1S/C12H20BrN3O/c1-2-3-6-17-7-4-5-16-12-10(13)8-15-9-11(12)14/h8-9H,2-7,14H2,1H3,(H,15,16) |
| InChIKey | JYGAFEFOPVLBJT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|