C10H17BrN4 — CID 103517564
5-bromo-4-N-[3-(dimethylamino)propyl]pyridine-3,4-diamine (PubChem CID 103517564) has the molecular formula C10H17BrN4 and a molecular weight of 273.18 g/mol. Its IUPAC name is 5-bromo-4-N-[3-(dimethylamino)propyl]pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-[3-(dimethylamino)propyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103517564 |
| Molecular Formula | C10H17BrN4 |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-bromo-4-N-[3-(dimethylamino)propyl]pyridine-3,4-diamine |
| SMILES | CN(C)CCCNc1c(N)cncc1Br |
| InChI | InChI=1S/C10H17BrN4/c1-15(2)5-3-4-14-10-8(11)6-13-7-9(10)12/h6-7H,3-5,12H2,1-2H3,(H,13,14) |
| InChIKey | AKENNJVGSDWTJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|