C11H17BrN4O — CID 116795940
6-bromo-2-N-(2-cyclopentyloxyethyl)pyrimidine-2,4-diamine (PubChem CID 116795940) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is 6-bromo-2-N-(2-cyclopentyloxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-(2-cyclopentyloxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116795940 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-bromo-2-N-(2-cyclopentyloxyethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Br)nc(NCCOC2CCCC2)n1 |
| InChI | InChI=1S/C11H17BrN4O/c12-9-7-10(13)16-11(15-9)14-5-6-17-8-3-1-2-4-8/h7-8H,1-6H2,(H3,13,14,15,16) |
| InChIKey | YXMNIOCUTWTIHV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|