C10H15BrN4S — CID 116796124
6-bromo-2-N-(thian-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 116796124) has the molecular formula C10H15BrN4S and a molecular weight of 303.23 g/mol. Its IUPAC name is 6-bromo-2-N-(thian-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-(thian-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796124 |
| Molecular Formula | C10H15BrN4S |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 6-bromo-2-N-(thian-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Br)nc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C10H15BrN4S/c11-8-5-9(12)15-10(14-8)13-6-7-3-1-2-4-16-7/h5,7H,1-4,6H2,(H3,12,13,14,15) |
| InChIKey | SWKDCDTWSJZYMA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |