C12H16BrFN2S — CID 116736139
4-bromo-5-fluoro-2-N-(thian-2-ylmethyl)benzene-1,2-diamine (PubChem CID 116736139) has the molecular formula C12H16BrFN2S and a molecular weight of 319.24 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-N-(thian-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-2-N-(thian-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 116736139 |
| Molecular Formula | C12H16BrFN2S |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 4-bromo-5-fluoro-2-N-(thian-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1NCC1CCCCS1 |
| InChI | InChI=1S/C12H16BrFN2S/c13-9-5-12(11(15)6-10(9)14)16-7-8-3-1-2-4-17-8/h5-6,8,16H,1-4,7,15H2 |
| InChIKey | YJXWNEGYMTVMLE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|