C13H18F2N2S — CID 80594855
2-(difluoromethyl)-1-N-(thian-2-ylmethyl)benzene-1,4-diamine (PubChem CID 80594855) has the molecular formula C13H18F2N2S and a molecular weight of 272.36 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(thian-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(thian-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 80594855 |
| Molecular Formula | C13H18F2N2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(thian-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCC2CCCCS2)c(C(F)F)c1 |
| InChI | InChI=1S/C13H18F2N2S/c14-13(15)11-7-9(16)4-5-12(11)17-8-10-3-1-2-6-18-10/h4-5,7,10,13,17H,1-3,6,8,16H2 |
| InChIKey | SKZBSDSMCXJLBU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|