C12H16ClFN2S — CID 80595124
4-chloro-5-fluoro-1-N-(thian-2-ylmethyl)benzene-1,2-diamine (PubChem CID 80595124) has the molecular formula C12H16ClFN2S and a molecular weight of 274.79 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-(thian-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-(thian-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 80595124 |
| Molecular Formula | C12H16ClFN2S |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-(thian-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(F)cc1NCC1CCCCS1 |
| InChI | InChI=1S/C12H16ClFN2S/c13-9-5-11(15)12(6-10(9)14)16-7-8-3-1-2-4-17-8/h5-6,8,16H,1-4,7,15H2 |
| InChIKey | GEPJYYRVCXWGRG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|