C12H16Cl2N2S — CID 106890621
2,6-dichloro-1-N-(thian-2-ylmethyl)benzene-1,4-diamine (PubChem CID 106890621) has the molecular formula C12H16Cl2N2S and a molecular weight of 291.25 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(thian-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(thian-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890621 |
| Molecular Formula | C12H16Cl2N2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2,6-dichloro-1-N-(thian-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NCC2CCCCS2)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2S/c13-10-5-8(15)6-11(14)12(10)16-7-9-3-1-2-4-17-9/h5-6,9,16H,1-4,7,15H2 |
| InChIKey | XCFOWHQRAFPGGC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|