C11H16ClN3S — CID 80612105
6-chloro-2-methyl-N-(thian-2-ylmethyl)pyrimidin-4-amine (PubChem CID 80612105) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-(thian-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methyl-N-(thian-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80612105 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 6-chloro-2-methyl-N-(thian-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)cc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C11H16ClN3S/c1-8-14-10(12)6-11(15-8)13-7-9-4-2-3-5-16-9/h6,9H,2-5,7H2,1H3,(H,13,14,15) |
| InChIKey | UGOMJBXMCQJDCU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |