C13H23N5S — CID 80852734
6-N-propyl-4-N-(thian-2-ylmethyl)pyrimidine-2,4,6-triamine (PubChem CID 80852734) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 6-N-propyl-4-N-(thian-2-ylmethyl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-propyl-4-N-(thian-2-ylmethyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80852734 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-N-propyl-4-N-(thian-2-ylmethyl)pyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(NCC2CCCCS2)nc(N)n1 |
| InChI | InChI=1S/C13H23N5S/c1-2-6-15-11-8-12(18-13(14)17-11)16-9-10-5-3-4-7-19-10/h8,10H,2-7,9H2,1H3,(H4,14,15,16,17,18) |
| InChIKey | NMQASQXPSGMCAW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |