C12H20N4S — CID 80950697
2-propyl-4-N-(thiolan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 80950697) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 2-propyl-4-N-(thiolan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 2-propyl-4-N-(thiolan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80950697 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-propyl-4-N-(thiolan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)cc(NCC2CCCS2)n1 |
| InChI | InChI=1S/C12H20N4S/c1-2-4-11-15-10(13)7-12(16-11)14-8-9-5-3-6-17-9/h7,9H,2-6,8H2,1H3,(H3,13,14,15,16) |
| InChIKey | ZGWURFABOSGDFE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |