C12H19N3S — CID 80852493
2-N-ethyl-6-N-(thiolan-2-ylmethyl)pyridine-2,6-diamine (PubChem CID 80852493) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(thiolan-2-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(thiolan-2-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80852493 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-N-ethyl-6-N-(thiolan-2-ylmethyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(NCC2CCCS2)n1 |
| InChI | InChI=1S/C12H19N3S/c1-2-13-11-6-3-7-12(15-11)14-9-10-5-4-8-16-10/h3,6-7,10H,2,4-5,8-9H2,1H3,(H2,13,14,15) |
| InChIKey | BOHQOFMPYMBZLW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |