C11H17N3S — CID 80646834
6-N-(thian-2-ylmethyl)pyridine-2,6-diamine (PubChem CID 80646834) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 6-N-(thian-2-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(thian-2-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80646834 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 6-N-(thian-2-ylmethyl)pyridine-2,6-diamine |
| SMILES | Nc1cccc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C11H17N3S/c12-10-5-3-6-11(14-10)13-8-9-4-1-2-7-15-9/h3,5-6,9H,1-2,4,7-8H2,(H3,12,13,14) |
| InChIKey | KLOPBKLHIRLAQQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |