C9H15BrN4OS — CID 106311435
3-[2-[(4-amino-6-bromopyrimidin-2-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311435) has the molecular formula C9H15BrN4OS and a molecular weight of 307.22 g/mol. Its IUPAC name is 3-[2-[(4-amino-6-bromopyrimidin-2-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(4-amino-6-bromopyrimidin-2-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311435 |
| Molecular Formula | C9H15BrN4OS |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3-[2-[(4-amino-6-bromopyrimidin-2-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | Nc1cc(Br)nc(NCCSCCCO)n1 |
| InChI | InChI=1S/C9H15BrN4OS/c10-7-6-8(11)14-9(13-7)12-2-5-16-4-1-3-15/h6,15H,1-5H2,(H3,11,12,13,14) |
| InChIKey | LDKUPCXSXWYBDT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|