C12H22N6O2S — CID 106311808
3-[2-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311808) has the molecular formula C12H22N6O2S and a molecular weight of 314.42 g/mol. Its IUPAC name is 3-[2-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311808 |
| Molecular Formula | C12H22N6O2S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[2-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | Nc1nc(NCCSCCCO)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H22N6O2S/c13-10-15-11(14-2-9-21-8-1-5-19)17-12(16-10)18-3-6-20-7-4-18/h19H,1-9H2,(H3,13,14,15,16,17) |
| InChIKey | IYFISVPTHSIDEX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|