C10H16N6O2S — CID 110178408
4-(2-hydroxyethylamino)-6-morpholin-4-yl-1,3,5-triazine-2-carbothioamide (PubChem CID 110178408) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-(2-hydroxyethylamino)-6-morpholin-4-yl-1,3,5-triazine-2-carbothioamide.
| Compound Name | 4-(2-hydroxyethylamino)-6-morpholin-4-yl-1,3,5-triazine-2-carbothioamide |
|---|---|
| PubChem CID | 110178408 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(2-hydroxyethylamino)-6-morpholin-4-yl-1,3,5-triazine-2-carbothioamide |
| SMILES | NC(=S)c1nc(NCCO)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H16N6O2S/c11-7(19)8-13-9(12-1-4-17)15-10(14-8)16-2-5-18-6-3-16/h17H,1-6H2,(H2,11,19)(H,12,13,14,15) |
| InChIKey | HVMMJDVVEGLJQL-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|